C21H38O5 — CID 59975037
1-O-methyl 6-O-[1-(oxiran-2-yl)ethyl] 2-(3,3-dimethylpentyl)-2,5,5-trimethylhexanedioate (PubChem CID 59975037) has the molecular formula C21H38O5 and a molecular weight of 370.53 g/mol. Its IUPAC name is 1-O-methyl 6-O-[1-(oxiran-2-yl)ethyl] 2-(3,3-dimethylpentyl)-2,5,5-trimethylhexanedioate.
| Compound Name | 1-O-methyl 6-O-[1-(oxiran-2-yl)ethyl] 2-(3,3-dimethylpentyl)-2,5,5-trimethylhexanedioate |
|---|---|
| PubChem CID | 59975037 |
| Molecular Formula | C21H38O5 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | 1-O-methyl 6-O-[1-(oxiran-2-yl)ethyl] 2-(3,3-dimethylpentyl)-2,5,5-trimethylhexanedioate |
| SMILES | CCC(C)(C)CCC(C)(CCC(C)(C)C(=O)OC(C)C1CO1)C(=O)OC |
| InChI | InChI=1S/C21H38O5/c1-9-19(3,4)10-12-21(7,18(23)24-8)13-11-20(5,6)17(22)26-15(2)16-14-25-16/h15-16H,9-14H2,1-8H3 |
| InChIKey | WACHHRPKJZXMDY-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|