C26H42O8 — CID 90740172
6-methyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one;trimethyl 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate (PubChem CID 90740172) has the molecular formula C26H42O8 and a molecular weight of 482.61 g/mol. Its IUPAC name is 6-methyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one;trimethyl 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate.
| Compound Name | 6-methyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one;trimethyl 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 90740172 |
| Molecular Formula | C26H42O8 |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | 6-methyl-4-oxatricyclo[4.2.1.03,7]nonan-5-one;trimethyl 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
| SMILES | CC12CC3CC(OC1=O)C2C3.CCC(C)(CC(C)(CC(C)(C)C(=O)OC)C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C17H30O6.C9H12O2/c1-9-16(4,13(19)22-7)11-17(5,14(20)23-8)10-15(2,3)12(18)21-6;1-9-4-5-2-6(9)7(3-5)11-8(9)10/h9-11H2,1-8H3;5-7H,2-4H2,1H3 |
| InChIKey | KEDTUQKBQBVOPI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|