C12H18N2O3 — CID 59975133
(3S)-3-[(2S,3E)-2-(methylamino)-3-(2-oxooxolan-3-ylidene)propyl]pyrrolidin-2-one (PubChem CID 59975133) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is (3S)-3-[(2S,3E)-2-(methylamino)-3-(2-oxooxolan-3-ylidene)propyl]pyrrolidin-2-one.
| Compound Name | (3S)-3-[(2S,3E)-2-(methylamino)-3-(2-oxooxolan-3-ylidene)propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 59975133 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | (3S)-3-[(2S,3E)-2-(methylamino)-3-(2-oxooxolan-3-ylidene)propyl]pyrrolidin-2-one |
| SMILES | CN[C@H](/C=C1\CCOC1=O)C[C@@H]1CCNC1=O |
| InChI | InChI=1S/C12H18N2O3/c1-13-10(6-8-2-4-14-11(8)15)7-9-3-5-17-12(9)16/h7-8,10,13H,2-6H2,1H3,(H,14,15)/b9-7+/t8-,10-/m0/s1 |
| InChIKey | GNWMLYMMOSAYHD-CFHQGVHJSA-N |
| XLogP | -0.03 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|