C16H20O4 — CID 59975384
[(2S)-pent-3-yn-2-yl] (E)-3-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)prop-2-enoate (PubChem CID 59975384) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is [(2S)-pent-3-yn-2-yl] (E)-3-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)prop-2-enoate.
| Compound Name | [(2S)-pent-3-yn-2-yl] (E)-3-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)prop-2-enoate |
|---|---|
| PubChem CID | 59975384 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | [(2S)-pent-3-yn-2-yl] (E)-3-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)prop-2-enoate |
| SMILES | CC#C[C@H](C)OC(=O)/C=C/C1=CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C16H20O4/c1-3-4-13(2)20-15(17)6-5-14-7-9-16(10-8-14)18-11-12-19-16/h5-7,13H,8-12H2,1-2H3/b6-5+/t13-/m0/s1 |
| InChIKey | UJZOSGLBMKDEQU-GFUIURDCSA-N |
| XLogP | 2.35 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|