C16H24O4 — CID 139030402
methyl (E)-3-(7-butyl-1,4-dioxaspiro[4.5]dec-6-en-6-yl)prop-2-enoate (PubChem CID 139030402) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is methyl (E)-3-(7-butyl-1,4-dioxaspiro[4.5]dec-6-en-6-yl)prop-2-enoate.
| Compound Name | methyl (E)-3-(7-butyl-1,4-dioxaspiro[4.5]dec-6-en-6-yl)prop-2-enoate |
|---|---|
| PubChem CID | 139030402 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | methyl (E)-3-(7-butyl-1,4-dioxaspiro[4.5]dec-6-en-6-yl)prop-2-enoate |
| SMILES | CCCCC1=C(/C=C/C(=O)OC)C2(CCC1)OCCO2 |
| InChI | InChI=1S/C16H24O4/c1-3-4-6-13-7-5-10-16(19-11-12-20-16)14(13)8-9-15(17)18-2/h8-9H,3-7,10-12H2,1-2H3/b9-8+ |
| InChIKey | TYUZUWIUEGSJSI-CMDGGOBGSA-N |
| XLogP | 3.13 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|