C40H50F2N4O6 — CID 59976451
[1-[2-[3-(3,4-difluorophenyl)-1-(3,4,5-trimethoxybenzoyl)pyrrolidin-3-yl]ethyl]piperidin-4-yl]-[1-(2-ethoxyethyl)-5-[(1Z,3Z)-penta-1,3-dienyl]imidazol-2-yl]methanone (PubChem CID 59976451) has the molecular formula C40H50F2N4O6 and a molecular weight of 720.86 g/mol. Its IUPAC name is [1-[2-[3-(3,4-difluorophenyl)-1-(3,4,5-trimethoxybenzoyl)pyrrolidin-3-yl]ethyl]piperidin-4-yl]-[1-(2-ethoxyethyl)-5-[(1Z,3Z)-penta-1,3-dienyl]imidazol-2-yl]methanone.
| Compound Name | [1-[2-[3-(3,4-difluorophenyl)-1-(3,4,5-trimethoxybenzoyl)pyrrolidin-3-yl]ethyl]piperidin-4-yl]-[1-(2-ethoxyethyl)-5-[(1Z,3Z)-penta-1,3-dienyl]imidazol-2-yl]methanone |
|---|---|
| PubChem CID | 59976451 |
| Molecular Formula | C40H50F2N4O6 |
| Molecular Weight | 720.86 g/mol |
| Exact Mass | 720.37 |
| IUPAC Name | [1-[2-[3-(3,4-difluorophenyl)-1-(3,4,5-trimethoxybenzoyl)pyrrolidin-3-yl]ethyl]piperidin-4-yl]-[1-(2-ethoxyethyl)-5-[(1Z,3Z)-penta-1,3-dienyl]imidazol-2-yl]methanone |
| SMILES | C/C=C\C=C/c1cnc(C(=O)C2CCN(CCC3(c4ccc(F)c(F)c4)CCN(C(=O)c4cc(OC)c(OC)c(OC)c4)C3)CC2)n1CCOCC |
| InChI | InChI=1S/C40H50F2N4O6/c1-6-8-9-10-31-26-43-38(46(31)21-22-52-7-2)36(47)28-13-17-44(18-14-28)19-15-40(30-11-12-32(41)33(42)25-30)16-20-45(27-40)39(48)29-23-34(49-3)37(51-5)35(24-29)50-4/h6,8-12,23-26,28H,7,13-22,27H2,1-5H3/b8-6-,10-9- |
| InChIKey | POEFMVHUJWCWJU-VAOAJWRNSA-N |
| XLogP | 6.58 |
| TPSA | 95.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.86 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|