C46H54N4O9 — CID 59976453
4-[[2-[1-[2-[3-(3,4-dimethoxyphenyl)-1-(3,4,5-trimethoxybenzoyl)pyrrolidin-3-yl]ethyl]piperidine-4-carbonyl]-5-[(1Z,3Z)-penta-1,3-dienyl]imidazol-1-yl]methyl]benzoic acid (PubChem CID 59976453) has the molecular formula C46H54N4O9 and a molecular weight of 806.96 g/mol. Its IUPAC name is 4-[[2-[1-[2-[3-(3,4-dimethoxyphenyl)-1-(3,4,5-trimethoxybenzoyl)pyrrolidin-3-yl]ethyl]piperidine-4-carbonyl]-5-[(1Z,3Z)-penta-1,3-dienyl]imidazol-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[2-[1-[2-[3-(3,4-dimethoxyphenyl)-1-(3,4,5-trimethoxybenzoyl)pyrrolidin-3-yl]ethyl]piperidine-4-carbonyl]-5-[(1Z,3Z)-penta-1,3-dienyl]imidazol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 59976453 |
| Molecular Formula | C46H54N4O9 |
| Molecular Weight | 806.96 g/mol |
| Exact Mass | 806.39 |
| IUPAC Name | 4-[[2-[1-[2-[3-(3,4-dimethoxyphenyl)-1-(3,4,5-trimethoxybenzoyl)pyrrolidin-3-yl]ethyl]piperidine-4-carbonyl]-5-[(1Z,3Z)-penta-1,3-dienyl]imidazol-1-yl]methyl]benzoic acid |
| SMILES | C/C=C\C=C/c1cnc(C(=O)C2CCN(CCC3(c4ccc(OC)c(OC)c4)CCN(C(=O)c4cc(OC)c(OC)c(OC)c4)C3)CC2)n1Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C46H54N4O9/c1-7-8-9-10-36-28-47-43(50(36)29-31-11-13-33(14-12-31)45(53)54)41(51)32-17-21-48(22-18-32)23-19-46(35-15-16-37(55-2)38(27-35)56-3)20-24-49(30-46)44(52)34-25-39(57-4)42(59-6)40(26-34)58-5/h7-16,25-28,32H,17-24,29-30H2,1-6H3,(H,53,54)/b8-7-,10-9- |
| InChIKey | VHFGIRRMVSIDIY-QRLRYFCNSA-N |
| XLogP | 7.03 |
| TPSA | 141.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.96 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|