C20H30O — CID 59976984
(10R,13S)-17-ethyl-13-methyl-1,2,3,6,7,8,9,10,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 59976984) has the molecular formula C20H30O and a molecular weight of 286.46 g/mol. Its IUPAC name is (10R,13S)-17-ethyl-13-methyl-1,2,3,6,7,8,9,10,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (10R,13S)-17-ethyl-13-methyl-1,2,3,6,7,8,9,10,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 59976984 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | (10R,13S)-17-ethyl-13-methyl-1,2,3,6,7,8,9,10,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CCC1=CCC2C3CCC4=CC(O)CC[C@@H]4C3CC[C@]12C |
| InChI | InChI=1S/C20H30O/c1-3-14-5-9-19-18-7-4-13-12-15(21)6-8-16(13)17(18)10-11-20(14,19)2/h5,12,15-19,21H,3-4,6-11H2,1-2H3/t15?,16-,17?,18?,19?,20+/m0/s1 |
| InChIKey | PJCCWJQMBGNHEW-KOEOHEQHSA-N |
| XLogP | 4.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|