C21H30O — CID 22796969
(8S,9S,10R,11S,13S,14S)-17-ethyl-10,13-dimethyl-6,7,8,9,11,12,14,15-octahydro-3H-cyclopenta[a]phenanthren-11-ol (PubChem CID 22796969) has the molecular formula C21H30O and a molecular weight of 298.47 g/mol. Its IUPAC name is (8S,9S,10R,11S,13S,14S)-17-ethyl-10,13-dimethyl-6,7,8,9,11,12,14,15-octahydro-3H-cyclopenta[a]phenanthren-11-ol.
| Compound Name | (8S,9S,10R,11S,13S,14S)-17-ethyl-10,13-dimethyl-6,7,8,9,11,12,14,15-octahydro-3H-cyclopenta[a]phenanthren-11-ol |
|---|---|
| PubChem CID | 22796969 |
| Molecular Formula | C21H30O |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | (8S,9S,10R,11S,13S,14S)-17-ethyl-10,13-dimethyl-6,7,8,9,11,12,14,15-octahydro-3H-cyclopenta[a]phenanthren-11-ol |
| SMILES | CCC1=CC[C@H]2[C@@H]3CCC4=CCC=C[C@]4(C)[C@H]3[C@@H](O)C[C@]12C |
| InChI | InChI=1S/C21H30O/c1-4-14-9-11-17-16-10-8-15-7-5-6-12-20(15,2)19(16)18(22)13-21(14,17)3/h6-7,9,12,16-19,22H,4-5,8,10-11,13H2,1-3H3/t16-,17-,18-,19+,20-,21+/m0/s1 |
| InChIKey | JMQUFYRLSYEEPP-LEZSPFLNSA-N |
| XLogP | 5.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|