C20H20Cl2N4O3 — CID 59977513
(2S,4R)-N-(1H-benzimidazol-2-ylmethyl)-1-[(3,5-dichloro-2-hydroxyphenyl)methyl]-4-hydroxypyrrolidine-2-carboxamide (PubChem CID 59977513) has the molecular formula C20H20Cl2N4O3 and a molecular weight of 435.31 g/mol. Its IUPAC name is (2S,4R)-N-(1H-benzimidazol-2-ylmethyl)-1-[(3,5-dichloro-2-hydroxyphenyl)methyl]-4-hydroxypyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-N-(1H-benzimidazol-2-ylmethyl)-1-[(3,5-dichloro-2-hydroxyphenyl)methyl]-4-hydroxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 59977513 |
| Molecular Formula | C20H20Cl2N4O3 |
| Molecular Weight | 435.31 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | (2S,4R)-N-(1H-benzimidazol-2-ylmethyl)-1-[(3,5-dichloro-2-hydroxyphenyl)methyl]-4-hydroxypyrrolidine-2-carboxamide |
| SMILES | O=C(NCc1nc2ccccc2[nH]1)[C@@H]1C[C@@H](O)CN1Cc1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C20H20Cl2N4O3/c21-12-5-11(19(28)14(22)6-12)9-26-10-13(27)7-17(26)20(29)23-8-18-24-15-3-1-2-4-16(15)25-18/h1-6,13,17,27-28H,7-10H2,(H,23,29)(H,24,25)/t13-,17+/m1/s1 |
| InChIKey | ZFHNVKXWYDQPSG-DYVFJYSZSA-N |
| XLogP | 2.83 |
| TPSA | 101.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|