C20H17F5N4O2 — CID 20594444
N-(1H-benzimidazol-2-ylmethyl)-4-hydroxy-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrrolidine-2-carboxamide (PubChem CID 20594444) has the molecular formula C20H17F5N4O2 and a molecular weight of 440.37 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-ylmethyl)-4-hydroxy-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrrolidine-2-carboxamide.
| Compound Name | N-(1H-benzimidazol-2-ylmethyl)-4-hydroxy-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 20594444 |
| Molecular Formula | C20H17F5N4O2 |
| Molecular Weight | 440.37 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | N-(1H-benzimidazol-2-ylmethyl)-4-hydroxy-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(NCc1nc2ccccc2[nH]1)C1CC(O)CN1Cc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C20H17F5N4O2/c21-15-10(16(22)18(24)19(25)17(15)23)8-29-7-9(30)5-13(29)20(31)26-6-14-27-11-3-1-2-4-12(11)28-14/h1-4,9,13,30H,5-8H2,(H,26,31)(H,27,28) |
| InChIKey | IXUGVJBIGGSXHA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 81.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|