C17H16N2O6S — CID 59980859
7-methoxy-N'-(3-methoxyphenyl)sulfonyl-1-benzofuran-2-carbohydrazide (PubChem CID 59980859) has the molecular formula C17H16N2O6S and a molecular weight of 376.39 g/mol. Its IUPAC name is 7-methoxy-N'-(3-methoxyphenyl)sulfonyl-1-benzofuran-2-carbohydrazide.
| Compound Name | 7-methoxy-N'-(3-methoxyphenyl)sulfonyl-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 59980859 |
| Molecular Formula | C17H16N2O6S |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 7-methoxy-N'-(3-methoxyphenyl)sulfonyl-1-benzofuran-2-carbohydrazide |
| SMILES | COc1cccc(S(=O)(=O)NNC(=O)c2cc3cccc(OC)c3o2)c1 |
| InChI | InChI=1S/C17H16N2O6S/c1-23-12-6-4-7-13(10-12)26(21,22)19-18-17(20)15-9-11-5-3-8-14(24-2)16(11)25-15/h3-10,19H,1-2H3,(H,18,20) |
| InChIKey | VWPCPBASBORTOK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|