C9H11ClN4O3S — CID 59981626
(NZ)-N-[5-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-methyl-1,3-oxazinan-4-ylidene]nitramide (PubChem CID 59981626) has the molecular formula C9H11ClN4O3S and a molecular weight of 290.73 g/mol. Its IUPAC name is (NZ)-N-[5-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-methyl-1,3-oxazinan-4-ylidene]nitramide.
| Compound Name | (NZ)-N-[5-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-methyl-1,3-oxazinan-4-ylidene]nitramide |
|---|---|
| PubChem CID | 59981626 |
| Molecular Formula | C9H11ClN4O3S |
| Molecular Weight | 290.73 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | (NZ)-N-[5-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-methyl-1,3-oxazinan-4-ylidene]nitramide |
| SMILES | CN1COCC(Cc2cnc(Cl)s2)/C1=N/[N+](=O)[O-] |
| InChI | InChI=1S/C9H11ClN4O3S/c1-13-5-17-4-6(8(13)12-14(15)16)2-7-3-11-9(10)18-7/h3,6H,2,4-5H2,1H3/b12-8- |
| InChIKey | MVQUTKKWOQKZPY-WQLSENKSSA-N |
| XLogP | 1.46 |
| TPSA | 80.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.73 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|