C10H14N4O3S — CID 88530649
(NZ)-N-[3-methyl-5-[(2-methyl-1,3-thiazol-5-yl)methyl]-1,3-oxazinan-4-ylidene]nitramide (PubChem CID 88530649) has the molecular formula C10H14N4O3S and a molecular weight of 270.31 g/mol. Its IUPAC name is (NZ)-N-[3-methyl-5-[(2-methyl-1,3-thiazol-5-yl)methyl]-1,3-oxazinan-4-ylidene]nitramide.
| Compound Name | (NZ)-N-[3-methyl-5-[(2-methyl-1,3-thiazol-5-yl)methyl]-1,3-oxazinan-4-ylidene]nitramide |
|---|---|
| PubChem CID | 88530649 |
| Molecular Formula | C10H14N4O3S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | (NZ)-N-[3-methyl-5-[(2-methyl-1,3-thiazol-5-yl)methyl]-1,3-oxazinan-4-ylidene]nitramide |
| SMILES | Cc1ncc(CC2COCN(C)/C2=N\[N+](=O)[O-])s1 |
| InChI | InChI=1S/C10H14N4O3S/c1-7-11-4-9(18-7)3-8-5-17-6-13(2)10(8)12-14(15)16/h4,8H,3,5-6H2,1-2H3/b12-10- |
| InChIKey | XHZOGHMKLXXNOW-BENRWUELSA-N |
| XLogP | 1.12 |
| TPSA | 80.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|