C22H20F3N5O3 — CID 59983061
[3-amino-5-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]phenyl]-morpholin-4-ylmethanone (PubChem CID 59983061) has the molecular formula C22H20F3N5O3 and a molecular weight of 459.43 g/mol. Its IUPAC name is [3-amino-5-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]phenyl]-morpholin-4-ylmethanone.
| Compound Name | [3-amino-5-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]phenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 59983061 |
| Molecular Formula | C22H20F3N5O3 |
| Molecular Weight | 459.43 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | [3-amino-5-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]phenyl]-morpholin-4-ylmethanone |
| SMILES | Nc1cc(C(=O)N2CCOCC2)cc(-c2cc(Nc3ccc(OC(F)(F)F)cc3)ncn2)c1 |
| InChI | InChI=1S/C22H20F3N5O3/c23-22(24,25)33-18-3-1-17(2-4-18)29-20-12-19(27-13-28-20)14-9-15(11-16(26)10-14)21(31)30-5-7-32-8-6-30/h1-4,9-13H,5-8,26H2,(H,27,28,29) |
| InChIKey | KBNLPTPXOZPJOG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 102.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|