C27H25FN4O6S2 — CID 59983162
[5-(1,1-dioxothiazinan-2-yl)-7-[(4-fluorophenyl)methylcarbamoyl]-1,6-naphthyridin-8-yl] 4-methylbenzenesulfonate (PubChem CID 59983162) has the molecular formula C27H25FN4O6S2 and a molecular weight of 584.65 g/mol. Its IUPAC name is [5-(1,1-dioxothiazinan-2-yl)-7-[(4-fluorophenyl)methylcarbamoyl]-1,6-naphthyridin-8-yl] 4-methylbenzenesulfonate.
| Compound Name | [5-(1,1-dioxothiazinan-2-yl)-7-[(4-fluorophenyl)methylcarbamoyl]-1,6-naphthyridin-8-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 59983162 |
| Molecular Formula | C27H25FN4O6S2 |
| Molecular Weight | 584.65 g/mol |
| Exact Mass | 584.12 |
| IUPAC Name | [5-(1,1-dioxothiazinan-2-yl)-7-[(4-fluorophenyl)methylcarbamoyl]-1,6-naphthyridin-8-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2c(C(=O)NCc3ccc(F)cc3)nc(N3CCCCS3(=O)=O)c3cccnc23)cc1 |
| InChI | InChI=1S/C27H25FN4O6S2/c1-18-6-12-21(13-7-18)40(36,37)38-25-23-22(5-4-14-29-23)26(32-15-2-3-16-39(32,34)35)31-24(25)27(33)30-17-19-8-10-20(28)11-9-19/h4-14H,2-3,15-17H2,1H3,(H,30,33) |
| InChIKey | CCHTUYTWQVJVHE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 135.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.65 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|