C27H33N3O3S — CID 59983395
2-[4-[5-[(4-ethylphenyl)carbamoyl]-1-pentylimidazol-2-yl]phenyl]sulfanyl-2-methylpropanoic acid (PubChem CID 59983395) has the molecular formula C27H33N3O3S and a molecular weight of 479.65 g/mol. Its IUPAC name is 2-[4-[5-[(4-ethylphenyl)carbamoyl]-1-pentylimidazol-2-yl]phenyl]sulfanyl-2-methylpropanoic acid.
| Compound Name | 2-[4-[5-[(4-ethylphenyl)carbamoyl]-1-pentylimidazol-2-yl]phenyl]sulfanyl-2-methylpropanoic acid |
|---|---|
| PubChem CID | 59983395 |
| Molecular Formula | C27H33N3O3S |
| Molecular Weight | 479.65 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | 2-[4-[5-[(4-ethylphenyl)carbamoyl]-1-pentylimidazol-2-yl]phenyl]sulfanyl-2-methylpropanoic acid |
| SMILES | CCCCCn1c(C(=O)Nc2ccc(CC)cc2)cnc1-c1ccc(SC(C)(C)C(=O)O)cc1 |
| InChI | InChI=1S/C27H33N3O3S/c1-5-7-8-17-30-23(25(31)29-21-13-9-19(6-2)10-14-21)18-28-24(30)20-11-15-22(16-12-20)34-27(3,4)26(32)33/h9-16,18H,5-8,17H2,1-4H3,(H,29,31)(H,32,33) |
| InChIKey | ZAIRQUXHWVTWKL-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.65 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|