C15H19NO3S3 — CID 59983833
4-methoxy-N-[(2R)-1-sulfanylpropan-2-yl]-N-(thiophen-3-ylmethyl)benzenesulfonamide (PubChem CID 59983833) has the molecular formula C15H19NO3S3 and a molecular weight of 357.52 g/mol. Its IUPAC name is 4-methoxy-N-[(2R)-1-sulfanylpropan-2-yl]-N-(thiophen-3-ylmethyl)benzenesulfonamide.
| Compound Name | 4-methoxy-N-[(2R)-1-sulfanylpropan-2-yl]-N-(thiophen-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 59983833 |
| Molecular Formula | C15H19NO3S3 |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | 4-methoxy-N-[(2R)-1-sulfanylpropan-2-yl]-N-(thiophen-3-ylmethyl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2ccsc2)[C@H](C)CS)cc1 |
| InChI | InChI=1S/C15H19NO3S3/c1-12(10-20)16(9-13-7-8-21-11-13)22(17,18)15-5-3-14(19-2)4-6-15/h3-8,11-12,20H,9-10H2,1-2H3/t12-/m1/s1 |
| InChIKey | WMPLYFFWXHOQLK-GFCCVEGCSA-N |
| XLogP | 3.27 |
| TPSA | 46.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|