C20H25NO3S3 — CID 59983876
S-[(4R)-4-[methyl-(4-phenylsulfanylphenyl)sulfonylamino]pentyl] ethanethioate (PubChem CID 59983876) has the molecular formula C20H25NO3S3 and a molecular weight of 423.63 g/mol. Its IUPAC name is S-[(4R)-4-[methyl-(4-phenylsulfanylphenyl)sulfonylamino]pentyl] ethanethioate.
| Compound Name | S-[(4R)-4-[methyl-(4-phenylsulfanylphenyl)sulfonylamino]pentyl] ethanethioate |
|---|---|
| PubChem CID | 59983876 |
| Molecular Formula | C20H25NO3S3 |
| Molecular Weight | 423.63 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | S-[(4R)-4-[methyl-(4-phenylsulfanylphenyl)sulfonylamino]pentyl] ethanethioate |
| SMILES | CC(=O)SCCC[C@@H](C)N(C)S(=O)(=O)c1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C20H25NO3S3/c1-16(8-7-15-25-17(2)22)21(3)27(23,24)20-13-11-19(12-14-20)26-18-9-5-4-6-10-18/h4-6,9-14,16H,7-8,15H2,1-3H3/t16-/m1/s1 |
| InChIKey | UTXRMBVWPCAMOY-MRXNPFEDSA-N |
| XLogP | 4.91 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.63 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|