C21H28N2O3S3 — CID 20732126
S-[2-[2-(dimethylamino)ethyl-(4-phenylsulfanylphenyl)sulfonylamino]propyl] ethanethioate (PubChem CID 20732126) has the molecular formula C21H28N2O3S3 and a molecular weight of 452.67 g/mol. Its IUPAC name is S-[2-[2-(dimethylamino)ethyl-(4-phenylsulfanylphenyl)sulfonylamino]propyl] ethanethioate.
| Compound Name | S-[2-[2-(dimethylamino)ethyl-(4-phenylsulfanylphenyl)sulfonylamino]propyl] ethanethioate |
|---|---|
| PubChem CID | 20732126 |
| Molecular Formula | C21H28N2O3S3 |
| Molecular Weight | 452.67 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | S-[2-[2-(dimethylamino)ethyl-(4-phenylsulfanylphenyl)sulfonylamino]propyl] ethanethioate |
| SMILES | CC(=O)SCC(C)N(CCN(C)C)S(=O)(=O)c1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C21H28N2O3S3/c1-17(16-27-18(2)24)23(15-14-22(3)4)29(25,26)21-12-10-20(11-13-21)28-19-8-6-5-7-9-19/h5-13,17H,14-16H2,1-4H3 |
| InChIKey | FUXPOKNIWWTGDY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.67 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|