C19H23N3O4S2 — CID 58599375
S-[2-[4-[2-(dimethylamino)ethyl-pyridin-4-ylsulfamoyl]phenyl]-2-oxoethyl] ethanethioate (PubChem CID 58599375) has the molecular formula C19H23N3O4S2 and a molecular weight of 421.54 g/mol. Its IUPAC name is S-[2-[4-[2-(dimethylamino)ethyl-pyridin-4-ylsulfamoyl]phenyl]-2-oxoethyl] ethanethioate.
| Compound Name | S-[2-[4-[2-(dimethylamino)ethyl-pyridin-4-ylsulfamoyl]phenyl]-2-oxoethyl] ethanethioate |
|---|---|
| PubChem CID | 58599375 |
| Molecular Formula | C19H23N3O4S2 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | S-[2-[4-[2-(dimethylamino)ethyl-pyridin-4-ylsulfamoyl]phenyl]-2-oxoethyl] ethanethioate |
| SMILES | CC(=O)SCC(=O)c1ccc(S(=O)(=O)N(CCN(C)C)c2ccncc2)cc1 |
| InChI | InChI=1S/C19H23N3O4S2/c1-15(23)27-14-19(24)16-4-6-18(7-5-16)28(25,26)22(13-12-21(2)3)17-8-10-20-11-9-17/h4-11H,12-14H2,1-3H3 |
| InChIKey | LJEJKGAXYHNUNF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 87.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|