C29H41N5O2 — CID 59985528
tert-butyl N-[(1S)-3-[8-(2-methyl-4,5,6,7-tetrahydroimidazo[4,5-c]pyridin-3-yl)-5-azatricyclo[4.3.0.01,4]nonan-5-yl]-1-phenylpropyl]carbamate (PubChem CID 59985528) has the molecular formula C29H41N5O2 and a molecular weight of 491.68 g/mol. Its IUPAC name is tert-butyl N-[(1S)-3-[8-(2-methyl-4,5,6,7-tetrahydroimidazo[4,5-c]pyridin-3-yl)-5-azatricyclo[4.3.0.01,4]nonan-5-yl]-1-phenylpropyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-3-[8-(2-methyl-4,5,6,7-tetrahydroimidazo[4,5-c]pyridin-3-yl)-5-azatricyclo[4.3.0.01,4]nonan-5-yl]-1-phenylpropyl]carbamate |
|---|---|
| PubChem CID | 59985528 |
| Molecular Formula | C29H41N5O2 |
| Molecular Weight | 491.68 g/mol |
| Exact Mass | 491.33 |
| IUPAC Name | tert-butyl N-[(1S)-3-[8-(2-methyl-4,5,6,7-tetrahydroimidazo[4,5-c]pyridin-3-yl)-5-azatricyclo[4.3.0.01,4]nonan-5-yl]-1-phenylpropyl]carbamate |
| SMILES | Cc1nc2c(n1C1CC3N(CC[C@H](NC(=O)OC(C)(C)C)c4ccccc4)C4CCC43C1)CNCC2 |
| InChI | InChI=1S/C29H41N5O2/c1-19-31-23-11-14-30-18-24(23)34(19)21-16-26-29(17-21)13-10-25(29)33(26)15-12-22(20-8-6-5-7-9-20)32-27(35)36-28(2,3)4/h5-9,21-22,25-26,30H,10-18H2,1-4H3,(H,32,35)/t21?,22-,25?,26?,29?/m0/s1 |
| InChIKey | CQQLYPHTWJTJOQ-PKNBKGABSA-N |
| XLogP | 4.66 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.68 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |