C14H17NO6 — CID 59989618
benzyl (2R)-2-[(4S,5S)-4,5-dihydroxy-3-oxooxazinan-2-yl]propanoate (PubChem CID 59989618) has the molecular formula C14H17NO6 and a molecular weight of 295.29 g/mol. Its IUPAC name is benzyl (2R)-2-[(4S,5S)-4,5-dihydroxy-3-oxooxazinan-2-yl]propanoate.
| Compound Name | benzyl (2R)-2-[(4S,5S)-4,5-dihydroxy-3-oxooxazinan-2-yl]propanoate |
|---|---|
| PubChem CID | 59989618 |
| Molecular Formula | C14H17NO6 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | benzyl (2R)-2-[(4S,5S)-4,5-dihydroxy-3-oxooxazinan-2-yl]propanoate |
| SMILES | C[C@H](C(=O)OCc1ccccc1)N1OC[C@H](O)[C@H](O)C1=O |
| InChI | InChI=1S/C14H17NO6/c1-9(15-13(18)12(17)11(16)8-21-15)14(19)20-7-10-5-3-2-4-6-10/h2-6,9,11-12,16-17H,7-8H2,1H3/t9-,11+,12+/m1/s1 |
| InChIKey | LKDRGEZWUOYDNK-USWWRNFRSA-N |
| XLogP | -0.39 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |