C26H28N4O3 — CID 59989936
(2R)-N-(aminomethyl)-3-naphthalen-2-yl-2-[[2-(2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)acetyl]amino]propanamide (PubChem CID 59989936) has the molecular formula C26H28N4O3 and a molecular weight of 444.54 g/mol. Its IUPAC name is (2R)-N-(aminomethyl)-3-naphthalen-2-yl-2-[[2-(2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)acetyl]amino]propanamide.
| Compound Name | (2R)-N-(aminomethyl)-3-naphthalen-2-yl-2-[[2-(2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 59989936 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | (2R)-N-(aminomethyl)-3-naphthalen-2-yl-2-[[2-(2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl)acetyl]amino]propanamide |
| SMILES | NCNC(=O)[C@@H](Cc1ccc2ccccc2c1)NC(=O)CN1C(=O)CCCc2ccccc21 |
| InChI | InChI=1S/C26H28N4O3/c27-17-28-26(33)22(15-18-12-13-19-6-1-2-8-21(19)14-18)29-24(31)16-30-23-10-4-3-7-20(23)9-5-11-25(30)32/h1-4,6-8,10,12-14,22H,5,9,11,15-17,27H2,(H,28,33)(H,29,31)/t22-/m1/s1 |
| InChIKey | SZEGRNMKNAFZFV-JOCHJYFZSA-N |
| XLogP | 2.27 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|