C31H30N4O3 — CID 59989940
(2R)-N-(aminomethyl)-3-naphthalen-2-yl-2-[[2-(6-oxo-11,12-dihydrobenzo[c][1]benzazocin-5-yl)acetyl]amino]propanamide (PubChem CID 59989940) has the molecular formula C31H30N4O3 and a molecular weight of 506.61 g/mol. Its IUPAC name is (2R)-N-(aminomethyl)-3-naphthalen-2-yl-2-[[2-(6-oxo-11,12-dihydrobenzo[c][1]benzazocin-5-yl)acetyl]amino]propanamide.
| Compound Name | (2R)-N-(aminomethyl)-3-naphthalen-2-yl-2-[[2-(6-oxo-11,12-dihydrobenzo[c][1]benzazocin-5-yl)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 59989940 |
| Molecular Formula | C31H30N4O3 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | (2R)-N-(aminomethyl)-3-naphthalen-2-yl-2-[[2-(6-oxo-11,12-dihydrobenzo[c][1]benzazocin-5-yl)acetyl]amino]propanamide |
| SMILES | NCNC(=O)[C@@H](Cc1ccc2ccccc2c1)NC(=O)CN1C(=O)c2ccccc2CCc2ccccc21 |
| InChI | InChI=1S/C31H30N4O3/c32-20-33-30(37)27(18-21-13-14-22-7-1-2-10-25(22)17-21)34-29(36)19-35-28-12-6-4-9-24(28)16-15-23-8-3-5-11-26(23)31(35)38/h1-14,17,27H,15-16,18-20,32H2,(H,33,37)(H,34,36)/t27-/m1/s1 |
| InChIKey | PBCWGEZSXJOLAD-HHHXNRCGSA-N |
| XLogP | 3.35 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|