C28H30AsN3O4S — CID 87882098
CID 87882098 (PubChem CID 87882098) has the molecular formula C28H30AsN3O4S and a molecular weight of 579.55 g/mol.
| Compound Name | CID 87882098 |
|---|---|
| PubChem CID | 87882098 |
| Molecular Formula | C28H30AsN3O4S |
| Molecular Weight | 579.55 g/mol |
| Exact Mass | 579.12 |
| IUPAC Name | — |
| SMILES | O=C(CCN1C(=O)CCSc2ccccc21)NC(Cc1ccc2ccccc2c1)C(=O)NCC(O)C[As] |
| InChI | InChI=1S/C28H30AsN3O4S/c29-17-22(33)18-30-28(36)23(16-19-9-10-20-5-1-2-6-21(20)15-19)31-26(34)11-13-32-24-7-3-4-8-25(24)37-14-12-27(32)35/h1-10,15,22-23,33H,11-14,16-18H2,(H,30,36)(H,31,34) |
| InChIKey | NNTNXMFSMVXGRB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.55 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|