C12H17NO2 — CID 59991777
2-[2-[3-(methylamino)propyl]phenoxy]acetaldehyde (PubChem CID 59991777) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 2-[2-[3-(methylamino)propyl]phenoxy]acetaldehyde.
| Compound Name | 2-[2-[3-(methylamino)propyl]phenoxy]acetaldehyde |
|---|---|
| PubChem CID | 59991777 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 2-[2-[3-(methylamino)propyl]phenoxy]acetaldehyde |
| SMILES | CNCCCc1ccccc1OCC=O |
| InChI | InChI=1S/C12H17NO2/c1-13-8-4-6-11-5-2-3-7-12(11)15-10-9-14/h2-3,5,7,9,13H,4,6,8,10H2,1H3 |
| InChIKey | QUOVKBKRLYQDPN-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|