C18H19ClN2O3 — CID 59991850
methyl 4-[[2-[2-(3-chlorophenyl)ethylamino]acetyl]amino]benzoate (PubChem CID 59991850) has the molecular formula C18H19ClN2O3 and a molecular weight of 346.81 g/mol. Its IUPAC name is methyl 4-[[2-[2-(3-chlorophenyl)ethylamino]acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[2-(3-chlorophenyl)ethylamino]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 59991850 |
| Molecular Formula | C18H19ClN2O3 |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | methyl 4-[[2-[2-(3-chlorophenyl)ethylamino]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CNCCc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C18H19ClN2O3/c1-24-18(23)14-5-7-16(8-6-14)21-17(22)12-20-10-9-13-3-2-4-15(19)11-13/h2-8,11,20H,9-10,12H2,1H3,(H,21,22) |
| InChIKey | GSJXCTRAOJFTJE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|