C17H22N2O2 — CID 59992362
(3aS,6R,7aR)-3,6-dimethyl-N-(2-nitrophenyl)-3a,4,5,6,7,7a-hexahydro-3H-inden-1-amine (PubChem CID 59992362) has the molecular formula C17H22N2O2 and a molecular weight of 286.37 g/mol. Its IUPAC name is (3aS,6R,7aR)-3,6-dimethyl-N-(2-nitrophenyl)-3a,4,5,6,7,7a-hexahydro-3H-inden-1-amine.
| Compound Name | (3aS,6R,7aR)-3,6-dimethyl-N-(2-nitrophenyl)-3a,4,5,6,7,7a-hexahydro-3H-inden-1-amine |
|---|---|
| PubChem CID | 59992362 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | (3aS,6R,7aR)-3,6-dimethyl-N-(2-nitrophenyl)-3a,4,5,6,7,7a-hexahydro-3H-inden-1-amine |
| SMILES | CC1C=C(Nc2ccccc2[N+](=O)[O-])[C@@H]2C[C@H](C)CC[C@@H]12 |
| InChI | InChI=1S/C17H22N2O2/c1-11-7-8-13-12(2)10-16(14(13)9-11)18-15-5-3-4-6-17(15)19(20)21/h3-6,10-14,18H,7-9H2,1-2H3/t11-,12?,13+,14-/m1/s1 |
| InChIKey | LLCPLVGGAMFPKY-NIWMIYJQSA-N |
| XLogP | 4.59 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|