C44H49N3O4S — CID 59993779
6-[4-(4-nitrophenyl)phenyl]sulfanylhexyl (Z)-3-[4-[(E)-2-[4-[hexyl(methyl)amino]-2-methylphenyl]ethenyl]phenyl]-2-isocyanoprop-2-enoate (PubChem CID 59993779) has the molecular formula C44H49N3O4S and a molecular weight of 715.96 g/mol. Its IUPAC name is 6-[4-(4-nitrophenyl)phenyl]sulfanylhexyl (Z)-3-[4-[(E)-2-[4-[hexyl(methyl)amino]-2-methylphenyl]ethenyl]phenyl]-2-isocyanoprop-2-enoate.
| Compound Name | 6-[4-(4-nitrophenyl)phenyl]sulfanylhexyl (Z)-3-[4-[(E)-2-[4-[hexyl(methyl)amino]-2-methylphenyl]ethenyl]phenyl]-2-isocyanoprop-2-enoate |
|---|---|
| PubChem CID | 59993779 |
| Molecular Formula | C44H49N3O4S |
| Molecular Weight | 715.96 g/mol |
| Exact Mass | 715.34 |
| IUPAC Name | 6-[4-(4-nitrophenyl)phenyl]sulfanylhexyl (Z)-3-[4-[(E)-2-[4-[hexyl(methyl)amino]-2-methylphenyl]ethenyl]phenyl]-2-isocyanoprop-2-enoate |
| SMILES | [C-]#[N+]/C(=C\c1ccc(/C=C/c2ccc(N(C)CCCCCC)cc2C)cc1)C(=O)OCCCCCCSc1ccc(-c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C44H49N3O4S/c1-5-6-7-10-29-46(4)41-26-19-37(34(2)32-41)18-17-35-13-15-36(16-14-35)33-43(45-3)44(48)51-30-11-8-9-12-31-52-42-27-22-39(23-28-42)38-20-24-40(25-21-38)47(49)50/h13-28,32-33H,5-12,29-31H2,1-2,4H3/b18-17+,43-33- |
| InChIKey | ZOQMOBTXOJSKTE-BUCDUUQQSA-N |
| XLogP | 11.91 |
| TPSA | 77.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.96 |
| LogP ≤ 5 | 11.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|