C24H32N4O4 — CID 59995972
N-[4-(dimethylamino)phenyl]-6,8-dimethoxy-1-morpholin-4-yl-3,4-dihydro-1H-isoquinoline-2-carboxamide (PubChem CID 59995972) has the molecular formula C24H32N4O4 and a molecular weight of 440.54 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-6,8-dimethoxy-1-morpholin-4-yl-3,4-dihydro-1H-isoquinoline-2-carboxamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-6,8-dimethoxy-1-morpholin-4-yl-3,4-dihydro-1H-isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 59995972 |
| Molecular Formula | C24H32N4O4 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-6,8-dimethoxy-1-morpholin-4-yl-3,4-dihydro-1H-isoquinoline-2-carboxamide |
| SMILES | COc1cc2c(c(OC)c1)C(N1CCOCC1)N(C(=O)Nc1ccc(N(C)C)cc1)CC2 |
| InChI | InChI=1S/C24H32N4O4/c1-26(2)19-7-5-18(6-8-19)25-24(29)28-10-9-17-15-20(30-3)16-21(31-4)22(17)23(28)27-11-13-32-14-12-27/h5-8,15-16,23H,9-14H2,1-4H3,(H,25,29) |
| InChIKey | GIXDDAVTFLRNKW-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 66.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|