C23H33N9O6 — CID 59996245
4-amino-5-[2-[[(2R,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylamino]ethyl]-1-[(2R,4S,5R)-5-ethyl-4-methoxyoxolan-2-yl]pyrimidin-2-one (PubChem CID 59996245) has the molecular formula C23H33N9O6 and a molecular weight of 531.57 g/mol. Its IUPAC name is 4-amino-5-[2-[[(2R,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylamino]ethyl]-1-[(2R,4S,5R)-5-ethyl-4-methoxyoxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-5-[2-[[(2R,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylamino]ethyl]-1-[(2R,4S,5R)-5-ethyl-4-methoxyoxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 59996245 |
| Molecular Formula | C23H33N9O6 |
| Molecular Weight | 531.57 g/mol |
| Exact Mass | 531.26 |
| IUPAC Name | 4-amino-5-[2-[[(2R,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylamino]ethyl]-1-[(2R,4S,5R)-5-ethyl-4-methoxyoxolan-2-yl]pyrimidin-2-one |
| SMILES | CC[C@H]1O[C@@H](n2cc(CCNC[C@H]3O[C@@H](n4cnc5c(N)ncnc54)[C@@H](O)C3O)c(N)nc2=O)C[C@@H]1OC |
| InChI | InChI=1S/C23H33N9O6/c1-3-12-13(36-2)6-15(37-12)31-8-11(19(24)30-23(31)35)4-5-26-7-14-17(33)18(34)22(38-14)32-10-29-16-20(25)27-9-28-21(16)32/h8-10,12-15,17-18,22,26,33-34H,3-7H2,1-2H3,(H2,24,30,35)(H2,25,27,28)/t12-,13+,14-,15-,17?,18+,22-/m1/s1 |
| InChIKey | LOIYNTBTQAGKSE-NVJPSKJCSA-N |
| XLogP | -1.29 |
| TPSA | 210.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.57 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|