C9H9NO6 — CID 59997468
4-O-(2,5-dioxopyrrolidin-1-yl) 1-O-methyl (Z)-but-2-enedioate (PubChem CID 59997468) has the molecular formula C9H9NO6 and a molecular weight of 227.17 g/mol. Its IUPAC name is 4-O-(2,5-dioxopyrrolidin-1-yl) 1-O-methyl (Z)-but-2-enedioate.
| Compound Name | 4-O-(2,5-dioxopyrrolidin-1-yl) 1-O-methyl (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 59997468 |
| Molecular Formula | C9H9NO6 |
| Molecular Weight | 227.17 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | 4-O-(2,5-dioxopyrrolidin-1-yl) 1-O-methyl (Z)-but-2-enedioate |
| SMILES | COC(=O)/C=C\C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C9H9NO6/c1-15-8(13)4-5-9(14)16-10-6(11)2-3-7(10)12/h4-5H,2-3H2,1H3/b5-4- |
| InChIKey | HCMATKKCKGLMEQ-PLNGDYQASA-N |
| XLogP | -0.68 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.17 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|