C22H17F3N3O2+ — CID 59999750
ethyl 3-naphthalen-2-yl-2-[3-(trifluoromethyl)-2-pyridinyl]-1H-pyrazol-2-ium-5-carboxylate (PubChem CID 59999750) has the molecular formula C22H17F3N3O2+ and a molecular weight of 412.39 g/mol. Its IUPAC name is ethyl 3-naphthalen-2-yl-2-[3-(trifluoromethyl)-2-pyridinyl]-1H-pyrazol-2-ium-5-carboxylate.
| Compound Name | ethyl 3-naphthalen-2-yl-2-[3-(trifluoromethyl)-2-pyridinyl]-1H-pyrazol-2-ium-5-carboxylate |
|---|---|
| PubChem CID | 59999750 |
| Molecular Formula | C22H17F3N3O2+ |
| Molecular Weight | 412.39 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | ethyl 3-naphthalen-2-yl-2-[3-(trifluoromethyl)-2-pyridinyl]-1H-pyrazol-2-ium-5-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccc3ccccc3c2)[n+](-c2ncccc2C(F)(F)F)[nH]1 |
| InChI | InChI=1S/C22H16F3N3O2/c1-2-30-21(29)18-13-19(16-10-9-14-6-3-4-7-15(14)12-16)28(27-18)20-17(22(23,24)25)8-5-11-26-20/h3-13H,2H2,1H3/p+1 |
| InChIKey | ZJZJZVHLVHYZCE-UHFFFAOYSA-O |
| XLogP | 4.70 |
| TPSA | 58.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.39 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|