C14H15NO2 — CID 600051
2,2-dimethyl-4,6-dihydro-3H-pyrano[3,2-c]quinolin-5-one (PubChem CID 600051) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is 2,2-dimethyl-4,6-dihydro-3H-pyrano[3,2-c]quinolin-5-one.
| Compound Name | 2,2-dimethyl-4,6-dihydro-3H-pyrano[3,2-c]quinolin-5-one |
|---|---|
| PubChem CID | 600051 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 2,2-dimethyl-4,6-dihydro-3H-pyrano[3,2-c]quinolin-5-one |
| SMILES | CC1(C)CCc2c(c3ccccc3[nH]c2=O)O1 |
| InChI | InChI=1S/C14H15NO2/c1-14(2)8-7-10-12(17-14)9-5-3-4-6-11(9)15-13(10)16/h3-6H,7-8H2,1-2H3,(H,15,16) |
| InChIKey | VXYKYULZMGGKJT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |