About methyl indolizine-2-carboxylate
methyl indolizine-2-carboxylate (PubChem CID 600232) has the molecular formula C10H9NO2
and a molecular weight of 175.19 g/mol. Its IUPAC name is methyl indolizine-2-carboxylate.
Molecular Properties
| Compound Name | methyl indolizine-2-carboxylate |
| PubChem CID | 600232 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | methyl indolizine-2-carboxylate |
| SMILES | COC(=O)c1cc2ccccn2c1 |
| InChI | InChI=1S/C10H9NO2/c1-13-10(12)8-6-9-4-2-3-5-11(9)7-8/h2-7H,1H3 |
| InChIKey | PZENCFVMMTWFIK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl indolizine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl indolizine-2-carboxylate?
The IUPAC name of methyl indolizine-2-carboxylate (CID 600232) is methyl indolizine-2-carboxylate.
What is the SMILES notation for methyl indolizine-2-carboxylate?
The canonical SMILES for methyl indolizine-2-carboxylate is COC(=O)c1cc2ccccn2c1.
What is the InChIKey of methyl indolizine-2-carboxylate?
The InChIKey is PZENCFVMMTWFIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO2/c1-13-10(12)8-6-9-4-2-3-5-11(9)7-8/h2-7H,1H3.
What are the key properties of methyl indolizine-2-carboxylate?
methyl indolizine-2-carboxylate has a molecular weight of 175.19 g/mol, XLogP of 1.73, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl indolizine-2-carboxylate is sourced from PubChem (CID 600232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).