C26H21N5O7S — CID 6005718
[4-[(Z)-[[2-[(4-methoxyphenyl)sulfamoyl]-4-nitrophenyl]hydrazinylidene]methyl]phenyl] pyridine-3-carboxylate (PubChem CID 6005718) has the molecular formula C26H21N5O7S and a molecular weight of 547.55 g/mol. Its IUPAC name is [4-[(Z)-[[2-[(4-methoxyphenyl)sulfamoyl]-4-nitrophenyl]hydrazinylidene]methyl]phenyl] pyridine-3-carboxylate.
| Compound Name | [4-[(Z)-[[2-[(4-methoxyphenyl)sulfamoyl]-4-nitrophenyl]hydrazinylidene]methyl]phenyl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 6005718 |
| Molecular Formula | C26H21N5O7S |
| Molecular Weight | 547.55 g/mol |
| Exact Mass | 547.12 |
| IUPAC Name | [4-[(Z)-[[2-[(4-methoxyphenyl)sulfamoyl]-4-nitrophenyl]hydrazinylidene]methyl]phenyl] pyridine-3-carboxylate |
| SMILES | COc1ccc(NS(=O)(=O)c2cc([N+](=O)[O-])ccc2N/N=C\c2ccc(OC(=O)c3cccnc3)cc2)cc1 |
| InChI | InChI=1S/C26H21N5O7S/c1-37-22-11-6-20(7-12-22)30-39(35,36)25-15-21(31(33)34)8-13-24(25)29-28-16-18-4-9-23(10-5-18)38-26(32)19-3-2-14-27-17-19/h2-17,29-30H,1H3/b28-16- |
| InChIKey | NNNOIAISNIRLSQ-NTFVMDSBSA-N |
| XLogP | 4.46 |
| TPSA | 162.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.55 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|