C6H12N2O5S2 — CID 600837
1,4-bis(methylsulfonyl)piperazin-2-one (PubChem CID 600837) has the molecular formula C6H12N2O5S2 and a molecular weight of 256.30 g/mol. Its IUPAC name is 1,4-bis(methylsulfonyl)piperazin-2-one.
| Compound Name | 1,4-bis(methylsulfonyl)piperazin-2-one |
|---|---|
| PubChem CID | 600837 |
| Molecular Formula | C6H12N2O5S2 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | 1,4-bis(methylsulfonyl)piperazin-2-one |
| SMILES | CS(=O)(=O)N1CCN(S(C)(=O)=O)C(=O)C1 |
| InChI | InChI=1S/C6H12N2O5S2/c1-14(10,11)7-3-4-8(6(9)5-7)15(2,12)13/h3-5H2,1-2H3 |
| InChIKey | XWVHKEYUNUEPGA-UHFFFAOYSA-N |
| XLogP | -1.95 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |