C5H8N2O4S — CID 66084034
4-methylsulfonylpiperazine-2,6-dione (PubChem CID 66084034) has the molecular formula C5H8N2O4S and a molecular weight of 192.20 g/mol. Its IUPAC name is 4-methylsulfonylpiperazine-2,6-dione.
| Compound Name | 4-methylsulfonylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66084034 |
| Molecular Formula | C5H8N2O4S |
| Molecular Weight | 192.20 g/mol |
| Exact Mass | 192.02 |
| IUPAC Name | 4-methylsulfonylpiperazine-2,6-dione |
| SMILES | CS(=O)(=O)N1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C5H8N2O4S/c1-12(10,11)7-2-4(8)6-5(9)3-7/h2-3H2,1H3,(H,6,8,9) |
| InChIKey | ZICUYOMCIOUZGA-UHFFFAOYSA-N |
| XLogP | -2.10 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.20 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|