C6H11N3O4S — CID 66084403
N,N-dimethyl-3,5-dioxopiperazine-1-sulfonamide (PubChem CID 66084403) has the molecular formula C6H11N3O4S and a molecular weight of 221.24 g/mol. Its IUPAC name is N,N-dimethyl-3,5-dioxopiperazine-1-sulfonamide.
| Compound Name | N,N-dimethyl-3,5-dioxopiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 66084403 |
| Molecular Formula | C6H11N3O4S |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | N,N-dimethyl-3,5-dioxopiperazine-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C6H11N3O4S/c1-8(2)14(12,13)9-3-5(10)7-6(11)4-9/h3-4H2,1-2H3,(H,7,10,11) |
| InChIKey | RKMKCCJZGSJNSN-UHFFFAOYSA-N |
| XLogP | -2.25 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|