C10H11NO2 — CID 600894
5-hydroxy-1,3-dimethyl-3H-indol-2-one (PubChem CID 600894) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is 5-hydroxy-1,3-dimethyl-3H-indol-2-one.
| Compound Name | 5-hydroxy-1,3-dimethyl-3H-indol-2-one |
|---|---|
| PubChem CID | 600894 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 5-hydroxy-1,3-dimethyl-3H-indol-2-one |
| SMILES | CC1C(=O)N(C)c2ccc(O)cc21 |
| InChI | InChI=1S/C10H11NO2/c1-6-8-5-7(12)3-4-9(8)11(2)10(6)13/h3-6,12H,1-2H3 |
| InChIKey | YQPARKFXCYFIBD-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |