C16H17BrN4O4 — CID 6011871
diethyl (Z,4E)-3-amino-4-[(4-bromophenyl)hydrazinylidene]-2-cyanopent-2-enedioate (PubChem CID 6011871) has the molecular formula C16H17BrN4O4 and a molecular weight of 409.24 g/mol. Its IUPAC name is diethyl (Z,4E)-3-amino-4-[(4-bromophenyl)hydrazinylidene]-2-cyanopent-2-enedioate.
| Compound Name | diethyl (Z,4E)-3-amino-4-[(4-bromophenyl)hydrazinylidene]-2-cyanopent-2-enedioate |
|---|---|
| PubChem CID | 6011871 |
| Molecular Formula | C16H17BrN4O4 |
| Molecular Weight | 409.24 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | diethyl (Z,4E)-3-amino-4-[(4-bromophenyl)hydrazinylidene]-2-cyanopent-2-enedioate |
| SMILES | CCOC(=O)/C(C#N)=C(N)/C(=N\Nc1ccc(Br)cc1)C(=O)OCC |
| InChI | InChI=1S/C16H17BrN4O4/c1-3-24-15(22)12(9-18)13(19)14(16(23)25-4-2)21-20-11-7-5-10(17)6-8-11/h5-8,20H,3-4,19H2,1-2H3/b13-12-,21-14+ |
| InChIKey | RQFRPFRUKJQFQI-UYEGHHEMSA-N |
| XLogP | 2.08 |
| TPSA | 126.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.24 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|