C12H14BrN3O2 — CID 6825854
ethyl 2-[(4-bromophenyl)hydrazinylidene]-3-iminobutanoate (PubChem CID 6825854) has the molecular formula C12H14BrN3O2 and a molecular weight of 312.17 g/mol. Its IUPAC name is ethyl 2-[(4-bromophenyl)hydrazinylidene]-3-iminobutanoate.
| Compound Name | ethyl 2-[(4-bromophenyl)hydrazinylidene]-3-iminobutanoate |
|---|---|
| PubChem CID | 6825854 |
| Molecular Formula | C12H14BrN3O2 |
| Molecular Weight | 312.17 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | ethyl 2-[(4-bromophenyl)hydrazinylidene]-3-iminobutanoate |
| SMILES | [H]/N=C(\C)C(=NNc1ccc(Br)cc1)C(=O)OCC |
| InChI | InChI=1S/C12H14BrN3O2/c1-3-18-12(17)11(8(2)14)16-15-10-6-4-9(13)5-7-10/h4-7,14-15H,3H2,1-2H3/b14-8+,16-11? |
| InChIKey | VNHOCGMMTBSGRO-YMPRBICMSA-N |
| XLogP | 2.82 |
| TPSA | 74.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.17 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|