C17H24BrN3O2 — CID 7722003
ethyl (2Z)-2-[(4-bromophenyl)hydrazinylidene]-2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]acetate (PubChem CID 7722003) has the molecular formula C17H24BrN3O2 and a molecular weight of 382.30 g/mol. Its IUPAC name is ethyl (2Z)-2-[(4-bromophenyl)hydrazinylidene]-2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]acetate.
| Compound Name | ethyl (2Z)-2-[(4-bromophenyl)hydrazinylidene]-2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]acetate |
|---|---|
| PubChem CID | 7722003 |
| Molecular Formula | C17H24BrN3O2 |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | ethyl (2Z)-2-[(4-bromophenyl)hydrazinylidene]-2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]acetate |
| SMILES | CCOC(=O)/C(=N/Nc1ccc(Br)cc1)N1[C@H](C)CCC[C@H]1C |
| InChI | InChI=1S/C17H24BrN3O2/c1-4-23-17(22)16(21-12(2)6-5-7-13(21)3)20-19-15-10-8-14(18)9-11-15/h8-13,19H,4-7H2,1-3H3/b20-16-/t12-,13-/m1/s1 |
| InChIKey | JFNMGPBKLXHVGL-ISORKSKUSA-N |
| XLogP | 4.00 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|