C14H13ClFN3O2S — CID 6016603
[(Z)-[4-[(2-chloro-4-fluorophenoxy)methyl]-5-methylthiophen-2-yl]methylideneamino]urea (PubChem CID 6016603) has the molecular formula C14H13ClFN3O2S and a molecular weight of 341.80 g/mol. Its IUPAC name is [(Z)-[4-[(2-chloro-4-fluorophenoxy)methyl]-5-methylthiophen-2-yl]methylideneamino]urea.
| Compound Name | [(Z)-[4-[(2-chloro-4-fluorophenoxy)methyl]-5-methylthiophen-2-yl]methylideneamino]urea |
|---|---|
| PubChem CID | 6016603 |
| Molecular Formula | C14H13ClFN3O2S |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | [(Z)-[4-[(2-chloro-4-fluorophenoxy)methyl]-5-methylthiophen-2-yl]methylideneamino]urea |
| SMILES | Cc1sc(/C=N\NC(N)=O)cc1COc1ccc(F)cc1Cl |
| InChI | InChI=1S/C14H13ClFN3O2S/c1-8-9(4-11(22-8)6-18-19-14(17)20)7-21-13-3-2-10(16)5-12(13)15/h2-6H,7H2,1H3,(H3,17,19,20)/b18-6- |
| InChIKey | SMUCQGGAGAGWDV-FXBPXSCXSA-N |
| XLogP | 3.43 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|