C19H18ClFN6OS — CID 6022803
2-[[5-[(3-chloroanilino)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(2-fluorophenyl)methylideneamino]acetamide (PubChem CID 6022803) has the molecular formula C19H18ClFN6OS and a molecular weight of 432.91 g/mol. Its IUPAC name is 2-[[5-[(3-chloroanilino)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(2-fluorophenyl)methylideneamino]acetamide.
| Compound Name | 2-[[5-[(3-chloroanilino)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(2-fluorophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6022803 |
| Molecular Formula | C19H18ClFN6OS |
| Molecular Weight | 432.91 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | 2-[[5-[(3-chloroanilino)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(2-fluorophenyl)methylideneamino]acetamide |
| SMILES | Cn1c(CNc2cccc(Cl)c2)nnc1SCC(=O)N/N=C\c1ccccc1F |
| InChI | InChI=1S/C19H18ClFN6OS/c1-27-17(11-22-15-7-4-6-14(20)9-15)24-26-19(27)29-12-18(28)25-23-10-13-5-2-3-8-16(13)21/h2-10,22H,11-12H2,1H3,(H,25,28)/b23-10- |
| InChIKey | JDXZLOISOMJYSG-RMORIDSASA-N |
| XLogP | 3.46 |
| TPSA | 84.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.91 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|