C19H14N8O6 — CID 6031270
2-[2-(4-amino-1,2,5-oxadiazol-3-yl)benzimidazol-1-yl]-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]acetamide (PubChem CID 6031270) has the molecular formula C19H14N8O6 and a molecular weight of 450.37 g/mol. Its IUPAC name is 2-[2-(4-amino-1,2,5-oxadiazol-3-yl)benzimidazol-1-yl]-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]acetamide.
| Compound Name | 2-[2-(4-amino-1,2,5-oxadiazol-3-yl)benzimidazol-1-yl]-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6031270 |
| Molecular Formula | C19H14N8O6 |
| Molecular Weight | 450.37 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | 2-[2-(4-amino-1,2,5-oxadiazol-3-yl)benzimidazol-1-yl]-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]acetamide |
| SMILES | Nc1nonc1-c1nc2ccccc2n1CC(=O)N/N=C\c1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C19H14N8O6/c20-18-17(24-33-25-18)19-22-11-3-1-2-4-12(11)26(19)8-16(28)23-21-7-10-5-14-15(32-9-31-14)6-13(10)27(29)30/h1-7H,8-9H2,(H2,20,25)(H,23,28)/b21-7- |
| InChIKey | JGMRFWPCGIVEGA-YXSASFKJSA-N |
| XLogP | 1.46 |
| TPSA | 185.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.37 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|