C20H21N3O2S — CID 6031869
N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[(Z)-1-(4-methylphenyl)ethylideneamino]oxyacetamide (PubChem CID 6031869) has the molecular formula C20H21N3O2S and a molecular weight of 367.47 g/mol. Its IUPAC name is N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[(Z)-1-(4-methylphenyl)ethylideneamino]oxyacetamide.
| Compound Name | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[(Z)-1-(4-methylphenyl)ethylideneamino]oxyacetamide |
|---|---|
| PubChem CID | 6031869 |
| Molecular Formula | C20H21N3O2S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-2-[(Z)-1-(4-methylphenyl)ethylideneamino]oxyacetamide |
| SMILES | C/C(=N/OCC(=O)Nc1sc2c(c1C#N)CCCC2)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H21N3O2S/c1-13-7-9-15(10-8-13)14(2)23-25-12-19(24)22-20-17(11-21)16-5-3-4-6-18(16)26-20/h7-10H,3-6,12H2,1-2H3,(H,22,24)/b23-14- |
| InChIKey | LCMHFTXIMNPZRO-UCQKPKSFSA-N |
| XLogP | 4.19 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|