C19H18BrN3O2S — CID 5442263
2-[(E)-1-(4-bromophenyl)ethylideneamino]oxy-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide (PubChem CID 5442263) has the molecular formula C19H18BrN3O2S and a molecular weight of 432.34 g/mol. Its IUPAC name is 2-[(E)-1-(4-bromophenyl)ethylideneamino]oxy-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide.
| Compound Name | 2-[(E)-1-(4-bromophenyl)ethylideneamino]oxy-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 5442263 |
| Molecular Formula | C19H18BrN3O2S |
| Molecular Weight | 432.34 g/mol |
| Exact Mass | 431.03 |
| IUPAC Name | 2-[(E)-1-(4-bromophenyl)ethylideneamino]oxy-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide |
| SMILES | C/C(=N\OCC(=O)Nc1sc2c(c1C#N)CCCC2)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H18BrN3O2S/c1-12(13-6-8-14(20)9-7-13)23-25-11-18(24)22-19-16(10-21)15-4-2-3-5-17(15)26-19/h6-9H,2-5,11H2,1H3,(H,22,24)/b23-12+ |
| InChIKey | JMNDCCQINHAKTC-FSJBWODESA-N |
| XLogP | 4.64 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.34 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|