C18H16N4O2 — CID 6036204
3-[(2Z)-2-[(4-prop-2-enoxyphenyl)methylidene]hydrazinyl]-1H-quinoxalin-2-one (PubChem CID 6036204) has the molecular formula C18H16N4O2 and a molecular weight of 320.35 g/mol. Its IUPAC name is 3-[(2Z)-2-[(4-prop-2-enoxyphenyl)methylidene]hydrazinyl]-1H-quinoxalin-2-one.
| Compound Name | 3-[(2Z)-2-[(4-prop-2-enoxyphenyl)methylidene]hydrazinyl]-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 6036204 |
| Molecular Formula | C18H16N4O2 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 3-[(2Z)-2-[(4-prop-2-enoxyphenyl)methylidene]hydrazinyl]-1H-quinoxalin-2-one |
| SMILES | C=CCOc1ccc(/C=N\Nc2nc3ccccc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C18H16N4O2/c1-2-11-24-14-9-7-13(8-10-14)12-19-22-17-18(23)21-16-6-4-3-5-15(16)20-17/h2-10,12H,1,11H2,(H,20,22)(H,21,23)/b19-12- |
| InChIKey | QTAQJDSVTSMBHT-UNOMPAQXSA-N |
| XLogP | 2.93 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|